CAS 137109-78-5 is the registry number for Orazipone. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(4-methylsulfonylphenyl)methylidene]pentane-2,4-dione (CAS 137109-78-5) is a chemical compound with the molecular formula C13H14O4S and a molecular weight of 266.31 g/mol. IUPAC name: 3-[(4-methylsulfonylphenyl)methylidene]pentane-2,4-dione. InChIKey: CAWYWWPWSAMGBV-UHFFFAOYSA-N.
| Molecular formula | C13H14O4S |
|---|---|
| Molecular weight | 266.31 g/mol |
| IUPAC name | 3-[(4-methylsulfonylphenyl)methylidene]pentane-2,4-dione |
| InChIKey | CAWYWWPWSAMGBV-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=CC1=CC=C(C=C1)S(=O)(=O)C)C(=O)C |
Computed by PubChem (NCBI)