CAS 1597410-34-8 is the registry number for (E)-S-Methyl 4-(3,4-dimethoxyphenyl)-2-oxobut-3-enethioate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
S-methyl (E)-4-(3,4-dimethoxyphenyl)-2-oxobut-3-enethioate (CAS 1597410-34-8) is a chemical compound with the molecular formula C13H14O4S and a molecular weight of 266.31 g/mol. IUPAC name: S-methyl (E)-4-(3,4-dimethoxyphenyl)-2-oxobut-3-enethioate. InChIKey: YIIQTNGBDJIDMI-GQCTYLIASA-N.
| Molecular formula | C13H14O4S |
|---|---|
| Molecular weight | 266.31 g/mol |
| IUPAC name | S-methyl (E)-4-(3,4-dimethoxyphenyl)-2-oxobut-3-enethioate |
| InChIKey | YIIQTNGBDJIDMI-GQCTYLIASA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)C(=O)SC)OC |
Computed by PubChem (NCBI)