Products 97852-72-7
CAS 97852-72-7 is the registry number for Tibenelast (free acid). Offered by: MedChemExpress. Available pack sizes: Get quote.
5,6-diethoxy-1-benzothiophene-2-carboxylic acid (CAS 97852-72-7) is a chemical compound with the molecular formula C13H14O4S and a molecular weight of 266.31 g/mol. IUPAC name: 5,6-diethoxy-1-benzothiophene-2-carboxylic acid. InChIKey: PDUXMHXBBXXJFQ-UHFFFAOYSA-N.
| Molecular formula | C13H14O4S |
|---|---|
| Molecular weight | 266.31 g/mol |
| IUPAC name | 5,6-diethoxy-1-benzothiophene-2-carboxylic acid |
| InChIKey | PDUXMHXBBXXJFQ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)C=C(S2)C(=O)O)OCC |
Computed by PubChem (NCBI)
Synonyms:
Tibenelast, Tibenclast, Tibenelastum, 5,6-diethoxybenzo[b]thiophene-2-carboxylic acid, 5,6-Diethoxybenzo(b)thiophene-2-carboxylic acid, Benzo(b)thiophene-2-carboxylic acid, 5,6-diethoxy-, 5,6-diethoxy-1-benzothiophene-2-carboxylic acid, Tibenelast [INN], 5,6-diethoxybenzothiophene-2-carboxylic acid, Tibenelastum [Latin]