Products 137188-20-6
CAS 137188-20-6 is the registry number for 5-Chloro-3-(4-fluorophenyl)isoxazole, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-chloro-3-(4-fluorophenyl)-1,2-oxazole (CAS 137188-20-6) is a chemical compound with the molecular formula C9H5ClFNO and a molecular weight of 197.59 g/mol. IUPAC name: 5-chloro-3-(4-fluorophenyl)-1,2-oxazole. InChIKey: SCRXBYPGBVETDN-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO |
|---|---|
| Molecular weight | 197.59 g/mol |
| IUPAC name | 5-chloro-3-(4-fluorophenyl)-1,2-oxazole |
| InChIKey | SCRXBYPGBVETDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=C2)Cl)F |
Computed by PubChem (NCBI)