Products 137195-33-6

CAS 137195-33-6 appears in our catalog under these names: 1,2-Dihydro-cinnolin-4-ol hydrochloride, 95%, 2,3-Dihydrocinnolin-4(1H)-one hydrochloride, 95%, 2,3–Dihydrocinnolin–4(1H)–one hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,3-dihydro-1H-cinnolin-4-one;hydrochloride (CAS 137195-33-6) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 2,3-dihydro-1H-cinnolin-4-one;hydrochloride. InChIKey: VLVHGNUUHYJMMG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClN2O
Molecular weight184.62 g/mol
IUPAC name2,3-dihydro-1H-cinnolin-4-one;hydrochloride
InChIKeyVLVHGNUUHYJMMG-UHFFFAOYSA-N
SMILESC1C(=O)C2=CC=CC=C2NN1.Cl

Computed by PubChem (NCBI)