CAS 137197-06-9 appears in our catalog under these names: Ac-Thr(Ac)-OH, Acetyl–O–acetyl–L–threonine, Acetyl-O-acetyl-L-threonine. Offered by: Creative Peptides, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 50mg, 5g.
(2S,3R)-2-acetamido-3-acetyloxybutanoic acid (CAS 137197-06-9) is a chemical compound with the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. IUPAC name: (2S,3R)-2-acetamido-3-acetyloxybutanoic acid. InChIKey: FHYSLJXFHVWFLV-FBCQKBJTSA-N.
| Molecular formula | C8H13NO5 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | (2S,3R)-2-acetamido-3-acetyloxybutanoic acid |
| InChIKey | FHYSLJXFHVWFLV-FBCQKBJTSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)