CAS 13720-04-2 is the registry number for 1,6-Dibromonaphthalen-2-amine, 98%. Offered by: AmBeed. Available pack sizes: 5g.
1,6-dibromonaphthalen-2-amine (CAS 13720-04-2) is a chemical compound with the molecular formula C10H7Br2N and a molecular weight of 300.98 g/mol. IUPAC name: 1,6-dibromonaphthalen-2-amine. InChIKey: YFTPQCFVHFJWSA-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2N |
|---|---|
| Molecular weight | 300.98 g/mol |
| IUPAC name | 1,6-dibromonaphthalen-2-amine |
| InChIKey | YFTPQCFVHFJWSA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2Br)N)C=C1Br |
Computed by PubChem (NCBI)