CAS 1780904-31-5 appears in our catalog under these names: 3,6–Dibromo–4–methylquinoline, 3,6-Dibromo-4-methylquinoline 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3,6-dibromo-4-methylquinoline (CAS 1780904-31-5) is a chemical compound with the molecular formula C10H7Br2N and a molecular weight of 300.98 g/mol. IUPAC name: 3,6-dibromo-4-methylquinoline. InChIKey: PZPWGXFLIHYFAC-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2N |
|---|---|
| Molecular weight | 300.98 g/mol |
| IUPAC name | 3,6-dibromo-4-methylquinoline |
| InChIKey | PZPWGXFLIHYFAC-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C=CC2=NC=C1Br)Br |
Computed by PubChem (NCBI)