CAS 88474-22-0 appears in our catalog under these names: 5-Bromo-8-(bromomethyl)quinoline, 95+%, 5-Bromo-8-(bromomethyl)quinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-8-(bromomethyl)quinoline (CAS 88474-22-0) is a chemical compound with the molecular formula C10H7Br2N and a molecular weight of 300.98 g/mol. IUPAC name: 5-bromo-8-(bromomethyl)quinoline. InChIKey: DGMZYNTVOVTLLH-UHFFFAOYSA-N.
| Molecular formula | C10H7Br2N |
|---|---|
| Molecular weight | 300.98 g/mol |
| IUPAC name | 5-bromo-8-(bromomethyl)quinoline |
| InChIKey | DGMZYNTVOVTLLH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)CBr)Br |
Computed by PubChem (NCBI)