CAS 137226-08-5 is the registry number for Aciclovir Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
N-(7-acetyl-6-oxo-1H-purin-2-yl)acetamide (CAS 137226-08-5) is a chemical compound with the molecular formula C9H9N5O3 and a molecular weight of 235.20 g/mol. IUPAC name: N-(7-acetyl-6-oxo-1H-purin-2-yl)acetamide. InChIKey: GETGEJGXNZNYSB-UHFFFAOYSA-N.
| Molecular formula | C9H9N5O3 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | N-(7-acetyl-6-oxo-1H-purin-2-yl)acetamide |
| InChIKey | GETGEJGXNZNYSB-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC2=C(C(=O)N1)N(C=N2)C(=O)C |
Computed by PubChem (NCBI)