CAS 442910-17-0 is the registry number for 6-(5-Methylfuran-2-yl)-5-nitropyrimidine-2,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(5-methylfuran-2-yl)-5-nitropyrimidine-2,4-diamine (CAS 442910-17-0) is a chemical compound with the molecular formula C9H9N5O3 and a molecular weight of 235.20 g/mol. IUPAC name: 6-(5-methylfuran-2-yl)-5-nitropyrimidine-2,4-diamine. InChIKey: VPUOJYLSZNTWOF-UHFFFAOYSA-N.
| Molecular formula | C9H9N5O3 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | 6-(5-methylfuran-2-yl)-5-nitropyrimidine-2,4-diamine |
| InChIKey | VPUOJYLSZNTWOF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C2=C(C(=NC(=N2)N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)