CAS 3056-33-5 appears in our catalog under these names: Acyclovir (Aciclovir) EP Impurity L, N2,9-Diacetylguanine, N2,9–Diacetylguanine, N(2),9-Diacetylguanine, 99% , N2,9-Diacetylguanine, >95.0%(T). Offered by: Chemat Brand, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: on request, 10g, 25g, 500g, 5g, 100g, 1kg, 0,5kg.
N-(9-acetyl-6-oxo-1H-purin-2-yl)acetamide (CAS 3056-33-5) is a chemical compound with the molecular formula C9H9N5O3 and a molecular weight of 235.20 g/mol. IUPAC name: N-(9-acetyl-6-oxo-1H-purin-2-yl)acetamide. InChIKey: GILZZWCROUGLIS-UHFFFAOYSA-N.
| Molecular formula | C9H9N5O3 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | N-(9-acetyl-6-oxo-1H-purin-2-yl)acetamide |
| InChIKey | GILZZWCROUGLIS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC2=C(C(=O)N1)N=CN2C(=O)C |
Computed by PubChem (NCBI)