CAS 137254-03-6 appears in our catalog under these names: (1R,2S)-2-Aminocyclopentanol hydrochloride 95%, (1R,2S)-2-Aminocyclopentanol hydrochloride, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
Cis-(1R,2S)-2-aminocyclopentan-1-ol;hydrochloride (CAS 137254-03-6) is a chemical compound with the molecular formula C5H12ClNO and a molecular weight of 137.61 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclopentan-1-ol;hydrochloride. InChIKey: ZFSXKSSWYSZPGQ-UYXJWNHNSA-N.
| Molecular formula | C5H12ClNO |
|---|---|
| Molecular weight | 137.61 g/mol |
| IUPAC name | cis-(1R,2S)-2-aminocyclopentan-1-ol;hydrochloride |
| InChIKey | ZFSXKSSWYSZPGQ-UYXJWNHNSA-N |
| SMILES | C1C[C@@H]([C@@H](C1)O)N.Cl |
Computed by PubChem (NCBI)