CAS 68327-11-7 appears in our catalog under these names: trans–(1R,2R)–2–Aminocyclopentanol Hydrochloride, (1R,2R)-2-Aminocyclopentanol Hydrochloride, >98.0%(T), (1R,2R)-2-Aminocyclopentanol hydrochloride 97%, (1R,2R)-TRANS-2-AMINOCYCLOPENTANOL HYDRO, trans-(1R,2R)-2-Aminocyclopentanol hydrochloride, 97%, 97%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g.
Trans-(1R,2R)-2-aminocyclopentan-1-ol;hydrochloride (CAS 68327-11-7) is a chemical compound with the molecular formula C5H12ClNO and a molecular weight of 137.61 g/mol. IUPAC name: trans-(1R,2R)-2-aminocyclopentan-1-ol;hydrochloride. InChIKey: ZFSXKSSWYSZPGQ-TYSVMGFPSA-N.
| Molecular formula | C5H12ClNO |
|---|---|
| Molecular weight | 137.61 g/mol |
| IUPAC name | trans-(1R,2R)-2-aminocyclopentan-1-ol;hydrochloride |
| InChIKey | ZFSXKSSWYSZPGQ-TYSVMGFPSA-N |
| SMILES | C1C[C@H]([C@@H](C1)O)N.Cl |
Computed by PubChem (NCBI)