CAS 31775-67-4 appears in our catalog under these names: Trans-2-aminocyclopentanol hydrochloride, 98%, trans-(1R,2R)-2-Aminocyclopentanol hydrochloride, trans-2-Aminocyclopentanol hydrochloride 98%, trans-2-Aminocyclopentanol Hydrochloride, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 50g.
Trans-(1R,2R)-2-aminocyclopentan-1-ol;hydrochloride (CAS 31775-67-4) is a chemical compound with the molecular formula C5H12ClNO and a molecular weight of 137.61 g/mol. IUPAC name: trans-(1R,2R)-2-aminocyclopentan-1-ol;hydrochloride. InChIKey: ZFSXKSSWYSZPGQ-TYSVMGFPSA-N.
| Molecular formula | C5H12ClNO |
|---|---|
| Molecular weight | 137.61 g/mol |
| IUPAC name | trans-(1R,2R)-2-aminocyclopentan-1-ol;hydrochloride |
| InChIKey | ZFSXKSSWYSZPGQ-TYSVMGFPSA-N |
| SMILES | C1C[C@H]([C@@H](C1)O)N.Cl |
Computed by PubChem (NCBI)