CAS 137267-29-9 appears in our catalog under these names: 2-Isopropyl-4-methyl-1,3-thiazole-5-carboxylic acid, 95%, 2-Isopropyl-4-methyl-1,3-thiazole-5-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid (CAS 137267-29-9) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: 4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid. InChIKey: MLCHZLUFNGBRSL-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | 4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | MLCHZLUFNGBRSL-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C(C)C)C(=O)O |
Computed by PubChem (NCBI)