CAS 137277-16-8 appears in our catalog under these names: (3r,4s)-Tetrahydrofuran-3,4-diamine dihydrochloride, 95%, cis-Tetrahydrofuran-3,4-diamine dihydrochloride, 97%, 97%, (3R,4S)-Tetrahydrofuran-3,4-diamine dihydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg.
(3R,4S)-oxolane-3,4-diamine;dihydrochloride (CAS 137277-16-8) is a chemical compound with the molecular formula C4H12Cl2N2O and a molecular weight of 175.05 g/mol. IUPAC name: (3R,4S)-oxolane-3,4-diamine;dihydrochloride. InChIKey: PJOPFTSMNUPXIB-NDXJVULZSA-N.
| Molecular formula | C4H12Cl2N2O |
|---|---|
| Molecular weight | 175.05 g/mol |
| IUPAC name | (3R,4S)-oxolane-3,4-diamine;dihydrochloride |
| InChIKey | PJOPFTSMNUPXIB-NDXJVULZSA-N |
| SMILES | C1[C@H]([C@H](CO1)N)N.Cl.Cl |
Computed by PubChem (NCBI)