CAS 137279-45-9 is the registry number for trans-Tetrahydrofuran-3,4-diamine dihydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
(3R,4R)-oxolane-3,4-diamine;dihydrochloride (CAS 137279-45-9) is a chemical compound with the molecular formula C4H12Cl2N2O and a molecular weight of 175.05 g/mol. IUPAC name: (3R,4R)-oxolane-3,4-diamine;dihydrochloride. InChIKey: PJOPFTSMNUPXIB-RGVONZFCSA-N.
| Molecular formula | C4H12Cl2N2O |
|---|---|
| Molecular weight | 175.05 g/mol |
| IUPAC name | (3R,4R)-oxolane-3,4-diamine;dihydrochloride |
| InChIKey | PJOPFTSMNUPXIB-RGVONZFCSA-N |
| SMILES | C1[C@@H]([C@H](CO1)N)N.Cl.Cl |
Computed by PubChem (NCBI)