CAS 220812-21-5 appears in our catalog under these names: (3S,4S)-4-Aminopyrrolidin-3-ol dihydrochloride, 97%, (3S,4S)4-Amino-3-Pyrrolidinol Dihydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g.
(3S,4S)-4-aminopyrrolidin-3-ol;dihydrochloride (CAS 220812-21-5) is a chemical compound with the molecular formula C4H12Cl2N2O and a molecular weight of 175.05 g/mol. IUPAC name: (3S,4S)-4-aminopyrrolidin-3-ol;dihydrochloride. InChIKey: ZIAZOHSJJZWBPV-RGVONZFCSA-N.
| Molecular formula | C4H12Cl2N2O |
|---|---|
| Molecular weight | 175.05 g/mol |
| IUPAC name | (3S,4S)-4-aminopyrrolidin-3-ol;dihydrochloride |
| InChIKey | ZIAZOHSJJZWBPV-RGVONZFCSA-N |
| SMILES | C1[C@@H]([C@H](CN1)O)N.Cl.Cl |
Computed by PubChem (NCBI)