CAS 1372778-66-9 appears in our catalog under these names: 2–(3–Biphenylyl)amino–9,9–dimethylfluorene, 2-(3-Biphenylyl)amino-9,9-dimethylfluorene, 9H-Fluoren-2-amine, N-[1,1'-biphenyl]-3-yl-9,9-dimethyl-, 98%, 98%, N-([1,1'-BIPHENYL]-3-YL)-9,9-DIMETHYL-9H-FLUOREN-2-AMINE, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
9,9-dimethyl-N-(3-phenylphenyl)fluoren-2-amine (CAS 1372778-66-9) is a chemical compound with the molecular formula C27H23N and a molecular weight of 361.5 g/mol. IUPAC name: 9,9-dimethyl-N-(3-phenylphenyl)fluoren-2-amine. InChIKey: SLMLVHPSGBYQPA-UHFFFAOYSA-N.
| Molecular formula | C27H23N |
|---|---|
| Molecular weight | 361.5 g/mol |
| IUPAC name | 9,9-dimethyl-N-(3-phenylphenyl)fluoren-2-amine |
| InChIKey | SLMLVHPSGBYQPA-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)NC4=CC=CC(=C4)C5=CC=CC=C5)C |
Computed by PubChem (NCBI)