CAS 1613331-97-7 is the registry number for N-([1,1'-Biphenyl]-3-yl)-9,9-dimethyl-9H-fluoren-3-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
9,9-dimethyl-N-(3-phenylphenyl)fluoren-3-amine (CAS 1613331-97-7) is a chemical compound with the molecular formula C27H23N and a molecular weight of 361.5 g/mol. IUPAC name: 9,9-dimethyl-N-(3-phenylphenyl)fluoren-3-amine. InChIKey: DOKNEWHMVVHGLD-UHFFFAOYSA-N.
| Molecular formula | C27H23N |
|---|---|
| Molecular weight | 361.5 g/mol |
| IUPAC name | 9,9-dimethyl-N-(3-phenylphenyl)fluoren-3-amine |
| InChIKey | DOKNEWHMVVHGLD-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)NC3=CC=CC(=C3)C4=CC=CC=C4)C5=CC=CC=C51)C |
Computed by PubChem (NCBI)