CAS 148077-51-4 is the registry number for 9,9-Dimethyl-n,n-diphenyl-9h-fluoren-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
9,9-dimethyl-N,N-diphenylfluoren-2-amine (CAS 148077-51-4) is a chemical compound with the molecular formula C27H23N and a molecular weight of 361.5 g/mol. IUPAC name: 9,9-dimethyl-N,N-diphenylfluoren-2-amine. InChIKey: LLAXDWLRVWTADE-UHFFFAOYSA-N.
| Molecular formula | C27H23N |
|---|---|
| Molecular weight | 361.5 g/mol |
| IUPAC name | 9,9-dimethyl-N,N-diphenylfluoren-2-amine |
| InChIKey | LLAXDWLRVWTADE-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC=C5)C |
Computed by PubChem (NCBI)