Products 13729-79-8
CAS 13729-79-8 is the registry number for 3-Methyl-1-tosylpiperidin-4-one, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-methyl-1-(4-methylphenyl)sulfonylpiperidin-4-one (CAS 13729-79-8) is a chemical compound with the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. IUPAC name: 3-methyl-1-(4-methylphenyl)sulfonylpiperidin-4-one. InChIKey: CEGLVGHCQTVTGP-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3S |
|---|---|
| Molecular weight | 267.35 g/mol |
| IUPAC name | 3-methyl-1-(4-methylphenyl)sulfonylpiperidin-4-one |
| InChIKey | CEGLVGHCQTVTGP-UHFFFAOYSA-N |
| SMILES | CC1CN(CCC1=O)S(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)