CAS 1373028-76-2 appears in our catalog under these names: 2–(1–Phenylethyl)–2,3–dihydroisothiazole 1,1–dioxide, 2-(1-Phenylethyl)-2,3-dihydroisothiazole 1,1-dioxide, 95+%, 2-(1-Phenyl-ethyl)-2,3-dihydro-isothiazole 1,1-dioxide, 95%. Offered by: GLPBio, AmBeed, Combi-blocks. Available pack sizes: 100mg, 250mg, 5g, 1g.
2-(1-phenylethyl)-3H-1,2-thiazole 1,1-dioxide (CAS 1373028-76-2) is a chemical compound with the molecular formula C11H13NO2S and a molecular weight of 223.29 g/mol. IUPAC name: 2-(1-phenylethyl)-3H-1,2-thiazole 1,1-dioxide. InChIKey: WRMQGYALQVAIKK-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2S |
|---|---|
| Molecular weight | 223.29 g/mol |
| IUPAC name | 2-(1-phenylethyl)-3H-1,2-thiazole 1,1-dioxide |
| InChIKey | WRMQGYALQVAIKK-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)N2CC=CS2(=O)=O |
Computed by PubChem (NCBI)