CAS 59668-69-8 is the registry number for 2-(4-Methylphenyl)-1,3-thiazolidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4-methylphenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 59668-69-8) is a chemical compound with the molecular formula C11H13NO2S and a molecular weight of 223.29 g/mol. IUPAC name: 2-(4-methylphenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: HTRWLFRKMUVNPG-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2S |
|---|---|
| Molecular weight | 223.29 g/mol |
| IUPAC name | 2-(4-methylphenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | HTRWLFRKMUVNPG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2NC(CS2)C(=O)O |
Computed by PubChem (NCBI)