Products 50739-30-5
CAS 50739-30-5 appears in our catalog under these names: 2-Benzyl-thiazolidine-4-carboxylic acid, 95%, 2-Benzylthiazolidine-4-carboxylic acid, 97%, 2-Benzyl-1,3-thiazolidine-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 5g, 1g, 2,5g.
2-benzyl-1,3-thiazolidine-4-carboxylic acid (CAS 50739-30-5) is a chemical compound with the molecular formula C11H13NO2S and a molecular weight of 223.29 g/mol. IUPAC name: 2-benzyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: SNFSDSLKMQQXDU-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2S |
|---|---|
| Molecular weight | 223.29 g/mol |
| IUPAC name | 2-benzyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | SNFSDSLKMQQXDU-UHFFFAOYSA-N |
| SMILES | C1C(NC(S1)CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)