Products 1373029-07-2
CAS 1373029-07-2 appears in our catalog under these names: 5–Amino–4–bromo–2–methylbenzoic acid, 5-amino-4-bromo-2-methylbenzoic acid, 5-Amino-4-bromo-2-methylbenzoic acid, 95%. Offered by: GLPBio, Biosynth, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
5-amino-4-bromo-2-methylbenzoic acid (CAS 1373029-07-2) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 5-amino-4-bromo-2-methylbenzoic acid. InChIKey: XSZRYXHZPQVXPW-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 5-amino-4-bromo-2-methylbenzoic acid |
| InChIKey | XSZRYXHZPQVXPW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)N)Br |
Computed by PubChem (NCBI)