CAS 1373038-57-3 appears in our catalog under these names: Valdecoxib 3'-Sulfonyl Chloride Impurity, Parecoxib Impurity 34. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-(5-methyl-4-phenyl-1,2-oxazol-3-yl)benzenesulfonyl chloride (CAS 1373038-57-3) is a chemical compound with the molecular formula C16H12ClNO3S and a molecular weight of 333.8 g/mol. IUPAC name: 3-(5-methyl-4-phenyl-1,2-oxazol-3-yl)benzenesulfonyl chloride. InChIKey: OVSWLIVHZCZFSG-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO3S |
|---|---|
| Molecular weight | 333.8 g/mol |
| IUPAC name | 3-(5-methyl-4-phenyl-1,2-oxazol-3-yl)benzenesulfonyl chloride |
| InChIKey | OVSWLIVHZCZFSG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC(=CC=C2)S(=O)(=O)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)