CAS 509074-26-4 appears in our catalog under these names: 4–(5–Methyl–3–phenyl–4–isoxazolyl)benzenesulfonyl chloride, 4-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonyl Chloride (Valdecoxib Sulfonyl Chloride), 4-(5-Methyl-3-phenylisoxazol-4-yl)benzene-1-sulfonyl chloride, 97%, 4-(5-Methyl-3-phenylisoxazol-4-yl)benzene-1-sulfonyl chloride, 97%, 97%, Valdecoxib Impurity 35. Offered by: GLPBio, Mikromol, Fluorochem, Chemat, Chemat Brand. Available pack sizes: 1g, 5g, 4x25mg, 25mg, 250mg, 10g, 25g, 100mg.
4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonyl chloride (CAS 509074-26-4) is a chemical compound with the molecular formula C16H12ClNO3S and a molecular weight of 333.8 g/mol. IUPAC name: 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonyl chloride. InChIKey: NVKQPOHDVWNXRP-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO3S |
|---|---|
| Molecular weight | 333.8 g/mol |
| IUPAC name | 4-(5-methyl-3-phenyl-1,2-oxazol-4-yl)benzenesulfonyl chloride |
| InChIKey | NVKQPOHDVWNXRP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C3=CC=C(C=C3)S(=O)(=O)Cl |
Computed by PubChem (NCBI)