CAS 2304623-42-3 is the registry number for Valdecoxib Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-methyl-4-phenyl-1,2-oxazol-3-yl)benzenesulfonyl chloride (CAS 2304623-42-3) is a chemical compound with the molecular formula C16H12ClNO3S and a molecular weight of 333.8 g/mol. IUPAC name: 2-(5-methyl-4-phenyl-1,2-oxazol-3-yl)benzenesulfonyl chloride. InChIKey: BFBJHVLTWPCMIC-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO3S |
|---|---|
| Molecular weight | 333.8 g/mol |
| IUPAC name | 2-(5-methyl-4-phenyl-1,2-oxazol-3-yl)benzenesulfonyl chloride |
| InChIKey | BFBJHVLTWPCMIC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2S(=O)(=O)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)