CAS 1373223-73-4 is the registry number for 8-Bromo-6-chloro-3,4-dihydro-2H-benzo(1,4)oxazine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (CAS 1373223-73-4) is a chemical compound with the molecular formula C8H8BrCl2NO and a molecular weight of 284.96 g/mol. IUPAC name: 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride. InChIKey: XVTZJIQRUMCLKF-UHFFFAOYSA-N.
| Molecular formula | C8H8BrCl2NO |
|---|---|
| Molecular weight | 284.96 g/mol |
| IUPAC name | 8-bromo-6-chloro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| InChIKey | XVTZJIQRUMCLKF-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=C(C=C2Br)Cl.Cl |
Computed by PubChem (NCBI)