CAS 1955498-43-7 is the registry number for 2-Amino-1-(2,6-dichlorophenyl)ethan-1-one hydrobromide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-amino-1-(2,6-dichlorophenyl)ethanone;hydrobromide (CAS 1955498-43-7) is a chemical compound with the molecular formula C8H8BrCl2NO and a molecular weight of 284.96 g/mol. IUPAC name: 2-amino-1-(2,6-dichlorophenyl)ethanone;hydrobromide. InChIKey: YAFXWBXJWQADOR-UHFFFAOYSA-N.
| Molecular formula | C8H8BrCl2NO |
|---|---|
| Molecular weight | 284.96 g/mol |
| IUPAC name | 2-amino-1-(2,6-dichlorophenyl)ethanone;hydrobromide |
| InChIKey | YAFXWBXJWQADOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)CN)Cl.Br |
Computed by PubChem (NCBI)