CAS 951915-17-6 appears in our catalog under these names: 2-(2-Aminoethoxy)-5-bromo-1,3-dichlorobenzene, 95%, 2-(2-Aminoethoxy)-5-bromo-1,3-dichlorobenzene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
2-(4-bromo-2,6-dichlorophenoxy)ethanamine (CAS 951915-17-6) is a chemical compound with the molecular formula C8H8BrCl2NO and a molecular weight of 284.96 g/mol. IUPAC name: 2-(4-bromo-2,6-dichlorophenoxy)ethanamine. InChIKey: USOXOAGZHSJAGB-UHFFFAOYSA-N.
| Molecular formula | C8H8BrCl2NO |
|---|---|
| Molecular weight | 284.96 g/mol |
| IUPAC name | 2-(4-bromo-2,6-dichlorophenoxy)ethanamine |
| InChIKey | USOXOAGZHSJAGB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)OCCN)Cl)Br |
Computed by PubChem (NCBI)