Products 1373307-59-5
CAS 1373307-59-5 appears in our catalog under these names: 5-Bromopyridine-3-sulfonyl fluoride, 98%, 5-Bromopyridine-3-sulfonyl fluoride, 98%, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-bromopyridine-3-sulfonyl fluoride (CAS 1373307-59-5) is a chemical compound with the molecular formula C5H3BrFNO2S and a molecular weight of 240.05 g/mol. IUPAC name: 5-bromopyridine-3-sulfonyl fluoride. InChIKey: HLOXACKFWCCLEM-UHFFFAOYSA-N.
| Molecular formula | C5H3BrFNO2S |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 5-bromopyridine-3-sulfonyl fluoride |
| InChIKey | HLOXACKFWCCLEM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Br)S(=O)(=O)F |
Computed by PubChem (NCBI)