CAS 1373759-05-7 appears in our catalog under these names: 4,4'-(2,2'-Bipyridine)-5,5'-diylbis(benzoic acid), 4,4'–((2,2'–Bipyridine)–5,5'–diyl)dibenzoic acid, 4,4'-([2,2'-Bipyridine]-5,5'-diyl)dibenzoic acid, 98%, 98%, 4,4'-([2,2'-Bipyridine]-5,5'-diyl)dibenzoic acid, 95%, 4,4'-([2,2'-Bipyridine]-5,5'-diyl)dibenzoic acid, 98%. Offered by: TRC, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
4-[6-[5-(4-carboxyphenyl)-2-pyridinyl]-3-pyridinyl]benzoic acid (CAS 1373759-05-7) is a chemical compound with the molecular formula C24H16N2O4 and a molecular weight of 396.4 g/mol. IUPAC name: 4-[6-[5-(4-carboxyphenyl)-2-pyridinyl]-3-pyridinyl]benzoic acid. InChIKey: FCXNVSNHZZTWCB-UHFFFAOYSA-N.
| Molecular formula | C24H16N2O4 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 4-[6-[5-(4-carboxyphenyl)-2-pyridinyl]-3-pyridinyl]benzoic acid |
| InChIKey | FCXNVSNHZZTWCB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(C=C2)C3=NC=C(C=C3)C4=CC=C(C=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)