CAS 7143-61-5 is the registry number for 2,6-Di-m-tolylpyrrolo[3,4-f]isoindole-1,3,5,7(2H,6H)-tetraone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-bis(3-methylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (CAS 7143-61-5) is a chemical compound with the molecular formula C24H16N2O4 and a molecular weight of 396.4 g/mol. IUPAC name: 2,6-bis(3-methylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone. InChIKey: KHYYZKOAWKXYKK-UHFFFAOYSA-N.
| Molecular formula | C24H16N2O4 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 2,6-bis(3-methylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| InChIKey | KHYYZKOAWKXYKK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=O)C3=CC4=C(C=C3C2=O)C(=O)N(C4=O)C5=CC=CC(=C5)C |
Computed by PubChem (NCBI)