Products 2459429-60-6
CAS 2459429-60-6 is the registry number for Di(pyridin-2-yl) [1,1'-biphenyl]-4,4'-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Pyridin-2-yl 4-(4-pyridin-2-yloxycarbonylphenyl)benzoate (CAS 2459429-60-6) is a chemical compound with the molecular formula C24H16N2O4 and a molecular weight of 396.4 g/mol. IUPAC name: pyridin-2-yl 4-(4-pyridin-2-yloxycarbonylphenyl)benzoate. InChIKey: CUUCZNQKVZJIFB-UHFFFAOYSA-N.
| Molecular formula | C24H16N2O4 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | pyridin-2-yl 4-(4-pyridin-2-yloxycarbonylphenyl)benzoate |
| InChIKey | CUUCZNQKVZJIFB-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)OC(=O)C2=CC=C(C=C2)C3=CC=C(C=C3)C(=O)OC4=CC=CC=N4 |
Computed by PubChem (NCBI)