CAS 137380-48-4 is the registry number for 3-Formyl-2,4,6-trimethylbenzyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3-formyl-2,4,6-trimethylphenyl)methyl acetate (CAS 137380-48-4) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: (3-formyl-2,4,6-trimethylphenyl)methyl acetate. InChIKey: AVAXHSXXDPQPIR-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | (3-formyl-2,4,6-trimethylphenyl)methyl acetate |
| InChIKey | AVAXHSXXDPQPIR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1COC(=O)C)C)C=O)C |
Computed by PubChem (NCBI)