Products 1374027-64-1
CAS 1374027-64-1 appears in our catalog under these names: Acetaminophen Impurity 31, Acetaminophen Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-(4-acetamidoanilino)-4-methylpentanoate (CAS 1374027-64-1) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: methyl (2S)-2-(4-acetamidoanilino)-4-methylpentanoate. InChIKey: WJHPSESGCIXIKT-AWEZNQCLSA-N.
| Molecular formula | C15H22N2O3 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | methyl (2S)-2-(4-acetamidoanilino)-4-methylpentanoate |
| InChIKey | WJHPSESGCIXIKT-AWEZNQCLSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)NC1=CC=C(C=C1)NC(=O)C |
Computed by PubChem (NCBI)