CAS 1374509-71-3 appears in our catalog under these names: 2-(4-tert-Butylphenyl)-3,4-dihydro-5h-1,3,4-benzotriazepin-5-one, 95%, 2-(4-(tert-Butyl)phenyl)-3H-benzo(e)(1,2,4)triazepin-5(4H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(4-tert-butylphenyl)-3,4-dihydro-1,3,4-benzotriazepin-5-one (CAS 1374509-71-3) is a chemical compound with the molecular formula C18H19N3O and a molecular weight of 293.4 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-3,4-dihydro-1,3,4-benzotriazepin-5-one. InChIKey: CXYWPQNBVHGAEQ-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-3,4-dihydro-1,3,4-benzotriazepin-5-one |
| InChIKey | CXYWPQNBVHGAEQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=O)NN2 |
Computed by PubChem (NCBI)