CAS 82644-31-3 is the registry number for Zolpidem tartrate Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
N-methyl-2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetamide (CAS 82644-31-3) is a chemical compound with the molecular formula C18H19N3O and a molecular weight of 293.4 g/mol. IUPAC name: N-methyl-2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetamide. InChIKey: JCJMXQKUQHDBCK-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | N-methyl-2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetamide |
| InChIKey | JCJMXQKUQHDBCK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(N3C=C(C=CC3=N2)C)CC(=O)NC |
Computed by PubChem (NCBI)