CAS 2460172-75-0 is the registry number for (S)-4-((S)-sec-Butyl)-2-(9H-pyrido[3,4-b]indol-1-yl)-4,5-dihydrooxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-4-[(2S)-butan-2-yl]-2-(9H-pyrido[3,4-b]indol-1-yl)-4,5-dihydro-1,3-oxazole (CAS 2460172-75-0) is a chemical compound with the molecular formula C18H19N3O and a molecular weight of 293.4 g/mol. IUPAC name: (4S)-4-[(2S)-butan-2-yl]-2-(9H-pyrido[3,4-b]indol-1-yl)-4,5-dihydro-1,3-oxazole. InChIKey: MZOYUFXVUKMFIF-XHDPSFHLSA-N.
| Molecular formula | C18H19N3O |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | (4S)-4-[(2S)-butan-2-yl]-2-(9H-pyrido[3,4-b]indol-1-yl)-4,5-dihydro-1,3-oxazole |
| InChIKey | MZOYUFXVUKMFIF-XHDPSFHLSA-N |
| SMILES | CC[C@H](C)[C@H]1COC(=N1)C2=NC=CC3=C2NC4=CC=CC=C34 |
Computed by PubChem (NCBI)