Products 1391116-69-0

CAS 1391116-69-0 is the registry number for tert-Butyl N-(2-amino-3,3-dimethylbutyl)carbamate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2-amino-3,3-dimethylbutyl)carbamate (CAS 1391116-69-0) is a chemical compound with the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. IUPAC name: tert-butyl N-(2-amino-3,3-dimethylbutyl)carbamate. InChIKey: OTSWUUVDIYKZTD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H24N2O2
Molecular weight216.32 g/mol
IUPAC nametert-butyl N-(2-amino-3,3-dimethylbutyl)carbamate
InChIKeyOTSWUUVDIYKZTD-UHFFFAOYSA-N
SMILESCC(C)(C)C(CNC(=O)OC(C)(C)C)N

Computed by PubChem (NCBI)