Products 1374831-02-3
CAS 1374831-02-3 is the registry number for 4-Chloro-2-(trifluoromethyl)thieno(2,3-d)pyrimidine, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
4-chloro-2-(trifluoromethyl)thieno[2,3-d]pyrimidine (CAS 1374831-02-3) is a chemical compound with the molecular formula C7H2ClF3N2S and a molecular weight of 238.62 g/mol. IUPAC name: 4-chloro-2-(trifluoromethyl)thieno[2,3-d]pyrimidine. InChIKey: BGEFLISGTFHGTJ-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3N2S |
|---|---|
| Molecular weight | 238.62 g/mol |
| IUPAC name | 4-chloro-2-(trifluoromethyl)thieno[2,3-d]pyrimidine |
| InChIKey | BGEFLISGTFHGTJ-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=NC(=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)