CAS 147972-27-8 appears in our catalog under these names: 4-Chloro-2-(trifluoromethyl)thieno[3,2-d]pyrimidine, 98%, 4-Chloro-2-(trifluoromethyl)thieno(3,2-d)pyrimidine, 98%, 4-Chloro-2-(trifluoromethyl)thieno[3,2-d]pyrimidine, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
4-chloro-2-(trifluoromethyl)thieno[3,2-d]pyrimidine (CAS 147972-27-8) is a chemical compound with the molecular formula C7H2ClF3N2S and a molecular weight of 238.62 g/mol. IUPAC name: 4-chloro-2-(trifluoromethyl)thieno[3,2-d]pyrimidine. InChIKey: ZUEIVUWZCAKOPP-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3N2S |
|---|---|
| Molecular weight | 238.62 g/mol |
| IUPAC name | 4-chloro-2-(trifluoromethyl)thieno[3,2-d]pyrimidine |
| InChIKey | ZUEIVUWZCAKOPP-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1N=C(N=C2Cl)C(F)(F)F |
Computed by PubChem (NCBI)