Products 884860-62-2
CAS 884860-62-2 appears in our catalog under these names: 2-Chloro-6-(trifluoromethyl)thiazolo[4,5-b]pyridine, 95%, 2-Chloro-6-(trifluoromethyl)thiazolo(4,5-b)pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-chloro-6-(trifluoromethyl)-[1,3]thiazolo[4,5-b]pyridine (CAS 884860-62-2) is a chemical compound with the molecular formula C7H2ClF3N2S and a molecular weight of 238.62 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)-[1,3]thiazolo[4,5-b]pyridine. InChIKey: FQZKCZBDVYCJMG-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3N2S |
|---|---|
| Molecular weight | 238.62 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)-[1,3]thiazolo[4,5-b]pyridine |
| InChIKey | FQZKCZBDVYCJMG-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1SC(=N2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)