CAS 1374849-76-9 is the registry number for tert-Butyl 2-hydrazinylpyridine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Tert-butyl 2-hydrazinylpyridine-3-carboxylate (CAS 1374849-76-9) is a chemical compound with the molecular formula C10H15N3O2 and a molecular weight of 209.24 g/mol. IUPAC name: tert-butyl 2-hydrazinylpyridine-3-carboxylate. InChIKey: HZXWGIZDRDYGHJ-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | tert-butyl 2-hydrazinylpyridine-3-carboxylate |
| InChIKey | HZXWGIZDRDYGHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(N=CC=C1)NN |
Computed by PubChem (NCBI)