CAS 183311-28-6 appears in our catalog under these names: Carbamic acid, n-(3-amino-4-pyridinyl)-, 1,1-dimethylethyl ester, 96%, tert-Butyl (3-aminopyridin-4-yl)carbamate, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 1g, 5g, 100g.
Tert-butyl N-(3-amino-4-pyridinyl)carbamate (CAS 183311-28-6) is a chemical compound with the molecular formula C10H15N3O2 and a molecular weight of 209.24 g/mol. IUPAC name: tert-butyl N-(3-amino-4-pyridinyl)carbamate. InChIKey: UVAXTPFOVJAXHO-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | tert-butyl N-(3-amino-4-pyridinyl)carbamate |
| InChIKey | UVAXTPFOVJAXHO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=NC=C1)N |
Computed by PubChem (NCBI)