Products 1375065-20-5
CAS 1375065-20-5 is the registry number for tert-Butyl 6-hydroxy-3-azabicyclo(3.2.1)octane-3-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 6-hydroxy-3-azabicyclo[3.2.1]octane-3-carboxylate (CAS 1375065-20-5) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl 6-hydroxy-3-azabicyclo[3.2.1]octane-3-carboxylate. InChIKey: TXQVFWQEKMBQMM-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl 6-hydroxy-3-azabicyclo[3.2.1]octane-3-carboxylate |
| InChIKey | TXQVFWQEKMBQMM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(C1)C(C2)O |
Computed by PubChem (NCBI)