Products 2803369-82-4
CAS 2803369-82-4 is the registry number for rac-tert-butyl (1R,5R,6R)-6-hydroxy-3-azabicyclo[3.2.1]octane-3-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl (1S,5S,6S)-6-hydroxy-3-azabicyclo[3.2.1]octane-3-carboxylate (CAS 2803369-82-4) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl (1S,5S,6S)-6-hydroxy-3-azabicyclo[3.2.1]octane-3-carboxylate. InChIKey: TXQVFWQEKMBQMM-GUBZILKMSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl (1S,5S,6S)-6-hydroxy-3-azabicyclo[3.2.1]octane-3-carboxylate |
| InChIKey | TXQVFWQEKMBQMM-GUBZILKMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H](C1)[C@H](C2)O |
Computed by PubChem (NCBI)